What is the 2,6-DIISOPROPYLNAPHTHALENE?

2,6-DIISOPROPYLNAPHTHALENE is beige crystalline platelets, while it's Molecular Formula is C16H20. beige crystalline platelets Used in Chemical Industry: 2,6-DIISOPROPYLNAPHTHALENE is used as an intermediate for the synthesis of various chemicals and compounds. Its unique structure allows it to be a versatile building block in the creation of different molecules, making it valuable in the chemical industry. Used in Pharmaceutical Industry: In the pharmaceutical industry, 2,6-DIISOPROPYLNAPHTHALENE is used as a starting material for the development of new drugs. Its chemical properties make it a promising candidate for the synthesis of novel therapeutic agents. Used in Dye Industry: 2,6-DIISOPROPYLNAPHTHALENE is used as a raw material in the production of dyes. Its distinct color characteristics enable it to be a valuable component in the formulation of various dye products. Used in Lubricant Industry: Due to its chemical properties, 2,6-DIISOPROPYLNAPHTHALENE is used as an additive in the lubricant industry. It helps improve the performance and longevity of lubricants, making it an essential component in the formulation of various lubricant products. Used in Polymer Industry: In the polymer industry, 2,6-DIISOPROPYLNAPHTHALENE is used as a monomer in the production of various types of polymers. Its unique structure allows it to be incorporated into the polymer chain, resulting in materials with enhanced properties. Used in Research and Development: 2,6-DIISOPROPYLNAPHTHALENE is also used in research and development settings as a test compound for studying various chemical reactions and processes. Its unique properties make it an interesting subject for scientific investigation and experimentation.

What is the CAS number for 2,6-DIISOPROPYLNAPHTHALENE?

The CAS number of 2,6-DIISOPROPYLNAPHTHALENE is 24157-81-1.

What is 2,6-DIISOPROPYLNAPHTHALENE (24157-81-1) used for?

2,6-DIISOPROPYLNAPHTHALENE is a clear yellowish-brown liquid with a faint sweet odor. It is characterized by its beige crystalline platelet structure, which contributes to its unique chemical properties.InChI:InChI=1/C16H20/c1-11(2)13-5-7-16-10-14(12(3)4)6-8-15(16)9-13/h5-12H,1-4H3